About N-[5-(1,1-difluoroethyl)-3-pyridinyl]-1,1-diphenylmethanimine
N-[5-(1,1-difluoroethyl)-3-pyridinyl]-1,1-diphenylmethanimine (PubChem CID 90020358) has the molecular formula C20H16F2N2
and a molecular weight of 322.36 g/mol. Its IUPAC name is N-[5-(1,1-difluoroethyl)-3-pyridinyl]-1,1-diphenylmethanimine.
Molecular Properties
| Compound Name | N-[5-(1,1-difluoroethyl)-3-pyridinyl]-1,1-diphenylmethanimine |
| PubChem CID | 90020358 |
| Molecular Formula | C20H16F2N2 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | N-[5-(1,1-difluoroethyl)-3-pyridinyl]-1,1-diphenylmethanimine |
| SMILES | CC(F)(F)c1cncc(N=C(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C20H16F2N2/c1-20(21,22)17-12-18(14-23-13-17)24-19(15-8-4-2-5-9-15)16-10-6-3-7-11-16/h2-14H,1H3 |
| InChIKey | KEUOKAXRHLRNCS-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-[5-(1,1-difluoroethyl)-3-pyridinyl]-1,1-diphenylmethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-(1,1-difluoroethyl)-3-pyridinyl]-1,1-diphenylmethanimine?
The IUPAC name of N-[5-(1,1-difluoroethyl)-3-pyridinyl]-1,1-diphenylmethanimine (CID 90020358) is N-[5-(1,1-difluoroethyl)-3-pyridinyl]-1,1-diphenylmethanimine.
What is the SMILES notation for N-[5-(1,1-difluoroethyl)-3-pyridinyl]-1,1-diphenylmethanimine?
The canonical SMILES for N-[5-(1,1-difluoroethyl)-3-pyridinyl]-1,1-diphenylmethanimine is CC(F)(F)c1cncc(N=C(c2ccccc2)c2ccccc2)c1.
What is the InChIKey of N-[5-(1,1-difluoroethyl)-3-pyridinyl]-1,1-diphenylmethanimine?
The InChIKey is KEUOKAXRHLRNCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16F2N2/c1-20(21,22)17-12-18(14-23-13-17)24-19(15-8-4-2-5-9-15)16-10-6-3-7-11-16/h2-14H,1H3.
What are the key properties of N-[5-(1,1-difluoroethyl)-3-pyridinyl]-1,1-diphenylmethanimine?
N-[5-(1,1-difluoroethyl)-3-pyridinyl]-1,1-diphenylmethanimine has a molecular weight of 322.36 g/mol, XLogP of 5.36, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-(1,1-difluoroethyl)-3-pyridinyl]-1,1-diphenylmethanimine is sourced from PubChem (CID 90020358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).