C23H16F2N4 — CID 170741206
N-[5-(difluoromethyl)-6-pyrimidin-2-yl-3-pyridinyl]-1,1-diphenylmethanimine (PubChem CID 170741206) has the molecular formula C23H16F2N4 and a molecular weight of 386.41 g/mol. Its IUPAC name is N-[5-(difluoromethyl)-6-pyrimidin-2-yl-3-pyridinyl]-1,1-diphenylmethanimine.
| Compound Name | N-[5-(difluoromethyl)-6-pyrimidin-2-yl-3-pyridinyl]-1,1-diphenylmethanimine |
|---|---|
| PubChem CID | 170741206 |
| Molecular Formula | C23H16F2N4 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | N-[5-(difluoromethyl)-6-pyrimidin-2-yl-3-pyridinyl]-1,1-diphenylmethanimine |
| SMILES | FC(F)c1cc(N=C(c2ccccc2)c2ccccc2)cnc1-c1ncccn1 |
| InChI | InChI=1S/C23H16F2N4/c24-22(25)19-14-18(15-28-21(19)23-26-12-7-13-27-23)29-20(16-8-3-1-4-9-16)17-10-5-2-6-11-17/h1-15,22H |
| InChIKey | HJGJXIGHMGLCEC-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 51.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|