C19H12ClN3 — CID 171466296
N-(5-chloro-6-isocyano-3-pyridinyl)-1,1-diphenylmethanimine (PubChem CID 171466296) has the molecular formula C19H12ClN3 and a molecular weight of 317.78 g/mol. Its IUPAC name is N-(5-chloro-6-isocyano-3-pyridinyl)-1,1-diphenylmethanimine.
| Compound Name | N-(5-chloro-6-isocyano-3-pyridinyl)-1,1-diphenylmethanimine |
|---|---|
| PubChem CID | 171466296 |
| Molecular Formula | C19H12ClN3 |
| Molecular Weight | 317.78 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | N-(5-chloro-6-isocyano-3-pyridinyl)-1,1-diphenylmethanimine |
| SMILES | [C-]#[N+]c1ncc(N=C(c2ccccc2)c2ccccc2)cc1Cl |
| InChI | InChI=1S/C19H12ClN3/c1-21-19-17(20)12-16(13-22-19)23-18(14-8-4-2-5-9-14)15-10-6-3-7-11-15/h2-13H |
| InChIKey | AILQOQYFAHLTHW-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 29.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.78 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|