C22H16F3N5O2S — CID 138559643
5-(benzhydrylideneamino)-2-[4-(trifluoromethyl)pyrazol-1-yl]pyridine-3-sulfonamide (PubChem CID 138559643) has the molecular formula C22H16F3N5O2S and a molecular weight of 471.46 g/mol. Its IUPAC name is 5-(benzhydrylideneamino)-2-[4-(trifluoromethyl)pyrazol-1-yl]pyridine-3-sulfonamide.
| Compound Name | 5-(benzhydrylideneamino)-2-[4-(trifluoromethyl)pyrazol-1-yl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 138559643 |
| Molecular Formula | C22H16F3N5O2S |
| Molecular Weight | 471.46 g/mol |
| Exact Mass | 471.10 |
| IUPAC Name | 5-(benzhydrylideneamino)-2-[4-(trifluoromethyl)pyrazol-1-yl]pyridine-3-sulfonamide |
| SMILES | NS(=O)(=O)c1cc(N=C(c2ccccc2)c2ccccc2)cnc1-n1cc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C22H16F3N5O2S/c23-22(24,25)17-12-28-30(14-17)21-19(33(26,31)32)11-18(13-27-21)29-20(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-14H,(H2,26,31,32) |
| InChIKey | NWZMRLKTQBHTDU-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 103.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.46 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|