C11H9F3IN3O2S — CID 121485081
3-ethylsulfonyl-2-(4-iodopyrazol-1-yl)-5-(trifluoromethyl)pyridine (PubChem CID 121485081) has the molecular formula C11H9F3IN3O2S and a molecular weight of 431.18 g/mol. Its IUPAC name is 3-ethylsulfonyl-2-(4-iodopyrazol-1-yl)-5-(trifluoromethyl)pyridine.
| Compound Name | 3-ethylsulfonyl-2-(4-iodopyrazol-1-yl)-5-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 121485081 |
| Molecular Formula | C11H9F3IN3O2S |
| Molecular Weight | 431.18 g/mol |
| Exact Mass | 430.94 |
| IUPAC Name | 3-ethylsulfonyl-2-(4-iodopyrazol-1-yl)-5-(trifluoromethyl)pyridine |
| SMILES | CCS(=O)(=O)c1cc(C(F)(F)F)cnc1-n1cc(I)cn1 |
| InChI | InChI=1S/C11H9F3IN3O2S/c1-2-21(19,20)9-3-7(11(12,13)14)4-16-10(9)18-6-8(15)5-17-18/h3-6H,2H2,1H3 |
| InChIKey | SUHICRLCAYVQDW-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.18 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|