C17H15F10N3O3S — CID 156732763
3-ethylsulfonyl-2-[4-(2,2,3,3,4,4,4-heptafluorobutoxy)-3,5-dimethylpyrazol-1-yl]-5-(trifluoromethyl)pyridine (PubChem CID 156732763) has the molecular formula C17H15F10N3O3S and a molecular weight of 531.37 g/mol. Its IUPAC name is 3-ethylsulfonyl-2-[4-(2,2,3,3,4,4,4-heptafluorobutoxy)-3,5-dimethylpyrazol-1-yl]-5-(trifluoromethyl)pyridine.
| Compound Name | 3-ethylsulfonyl-2-[4-(2,2,3,3,4,4,4-heptafluorobutoxy)-3,5-dimethylpyrazol-1-yl]-5-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 156732763 |
| Molecular Formula | C17H15F10N3O3S |
| Molecular Weight | 531.37 g/mol |
| Exact Mass | 531.07 |
| IUPAC Name | 3-ethylsulfonyl-2-[4-(2,2,3,3,4,4,4-heptafluorobutoxy)-3,5-dimethylpyrazol-1-yl]-5-(trifluoromethyl)pyridine |
| SMILES | CCS(=O)(=O)c1cc(C(F)(F)F)cnc1-n1nc(C)c(OCC(F)(F)C(F)(F)C(F)(F)F)c1C |
| InChI | InChI=1S/C17H15F10N3O3S/c1-4-34(31,32)11-5-10(15(20,21)22)6-28-13(11)30-9(3)12(8(2)29-30)33-7-14(18,19)16(23,24)17(25,26)27/h5-6H,4,7H2,1-3H3 |
| InChIKey | OFNMESUAUBWKOB-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.37 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|