C14H11F8N3O2S — CID 168753793
3-ethylsulfonyl-2-[1-methyl-5-(1,1,2,2,2-pentafluoroethyl)imidazol-2-yl]-5-(trifluoromethyl)pyridine (PubChem CID 168753793) has the molecular formula C14H11F8N3O2S and a molecular weight of 437.31 g/mol. Its IUPAC name is 3-ethylsulfonyl-2-[1-methyl-5-(1,1,2,2,2-pentafluoroethyl)imidazol-2-yl]-5-(trifluoromethyl)pyridine.
| Compound Name | 3-ethylsulfonyl-2-[1-methyl-5-(1,1,2,2,2-pentafluoroethyl)imidazol-2-yl]-5-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 168753793 |
| Molecular Formula | C14H11F8N3O2S |
| Molecular Weight | 437.31 g/mol |
| Exact Mass | 437.04 |
| IUPAC Name | 3-ethylsulfonyl-2-[1-methyl-5-(1,1,2,2,2-pentafluoroethyl)imidazol-2-yl]-5-(trifluoromethyl)pyridine |
| SMILES | CCS(=O)(=O)c1cc(C(F)(F)F)cnc1-c1ncc(C(F)(F)C(F)(F)F)n1C |
| InChI | InChI=1S/C14H11F8N3O2S/c1-3-28(26,27)8-4-7(13(17,18)19)5-23-10(8)11-24-6-9(25(11)2)12(15,16)14(20,21)22/h4-6H,3H2,1-2H3 |
| InChIKey | LWTPJFFAAZTWJE-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.31 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|