C14H12F9N5O2S — CID 162493019
5-ethylsulfonyl-4-[1-methyl-5-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)imidazol-2-yl]pyrimidin-2-amine (PubChem CID 162493019) has the molecular formula C14H12F9N5O2S and a molecular weight of 485.33 g/mol. Its IUPAC name is 5-ethylsulfonyl-4-[1-methyl-5-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)imidazol-2-yl]pyrimidin-2-amine.
| Compound Name | 5-ethylsulfonyl-4-[1-methyl-5-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)imidazol-2-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 162493019 |
| Molecular Formula | C14H12F9N5O2S |
| Molecular Weight | 485.33 g/mol |
| Exact Mass | 485.06 |
| IUPAC Name | 5-ethylsulfonyl-4-[1-methyl-5-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)imidazol-2-yl]pyrimidin-2-amine |
| SMILES | CCS(=O)(=O)c1cnc(N)nc1-c1ncc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)n1C |
| InChI | InChI=1S/C14H12F9N5O2S/c1-3-31(29,30)6-4-26-10(24)27-8(6)9-25-5-7(28(9)2)11(15,16)12(17,18)13(19,20)14(21,22)23/h4-5H,3H2,1-2H3,(H2,24,26,27) |
| InChIKey | ZOAAMVVWIVBFQJ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.33 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|