C19H12F9N5O2S — CID 137374866
5-ethylsulfonyl-4-[5-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-2-pyridinyl]-2-pyrimidin-2-ylpyrimidine (PubChem CID 137374866) has the molecular formula C19H12F9N5O2S and a molecular weight of 545.39 g/mol. Its IUPAC name is 5-ethylsulfonyl-4-[5-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-2-pyridinyl]-2-pyrimidin-2-ylpyrimidine.
| Compound Name | 5-ethylsulfonyl-4-[5-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-2-pyridinyl]-2-pyrimidin-2-ylpyrimidine |
|---|---|
| PubChem CID | 137374866 |
| Molecular Formula | C19H12F9N5O2S |
| Molecular Weight | 545.39 g/mol |
| Exact Mass | 545.06 |
| IUPAC Name | 5-ethylsulfonyl-4-[5-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-2-pyridinyl]-2-pyrimidin-2-ylpyrimidine |
| SMILES | CCS(=O)(=O)c1cnc(-c2ncccn2)nc1-c1ccc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cn1 |
| InChI | InChI=1S/C19H12F9N5O2S/c1-2-36(34,35)12-9-32-15(14-29-6-3-7-30-14)33-13(12)11-5-4-10(8-31-11)16(20,21)17(22,23)18(24,25)19(26,27)28/h3-9H,2H2,1H3 |
| InChIKey | QTTWUSJHAIETJQ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 98.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.39 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|