C15H17F2N3O2S — CID 159537854
N-(2,2-difluoropropyl)-6-(3-ethylsulfonyl-2-pyridinyl)pyridin-3-amine (PubChem CID 159537854) has the molecular formula C15H17F2N3O2S and a molecular weight of 341.38 g/mol. Its IUPAC name is N-(2,2-difluoropropyl)-6-(3-ethylsulfonyl-2-pyridinyl)pyridin-3-amine.
| Compound Name | N-(2,2-difluoropropyl)-6-(3-ethylsulfonyl-2-pyridinyl)pyridin-3-amine |
|---|---|
| PubChem CID | 159537854 |
| Molecular Formula | C15H17F2N3O2S |
| Molecular Weight | 341.38 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | N-(2,2-difluoropropyl)-6-(3-ethylsulfonyl-2-pyridinyl)pyridin-3-amine |
| SMILES | CCS(=O)(=O)c1cccnc1-c1ccc(NCC(C)(F)F)cn1 |
| InChI | InChI=1S/C15H17F2N3O2S/c1-3-23(21,22)13-5-4-8-18-14(13)12-7-6-11(9-19-12)20-10-15(2,16)17/h4-9,20H,3,10H2,1-2H3 |
| InChIKey | MDVAHABYUBASTC-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.38 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |