C15H16F2N2O3S — CID 134166732
2-[5-(2,2-difluoropropoxy)-2-pyridinyl]-3-ethylsulfonylpyridine (PubChem CID 134166732) has the molecular formula C15H16F2N2O3S and a molecular weight of 342.37 g/mol. Its IUPAC name is 2-[5-(2,2-difluoropropoxy)-2-pyridinyl]-3-ethylsulfonylpyridine.
| Compound Name | 2-[5-(2,2-difluoropropoxy)-2-pyridinyl]-3-ethylsulfonylpyridine |
|---|---|
| PubChem CID | 134166732 |
| Molecular Formula | C15H16F2N2O3S |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | 2-[5-(2,2-difluoropropoxy)-2-pyridinyl]-3-ethylsulfonylpyridine |
| SMILES | CCS(=O)(=O)c1cccnc1-c1ccc(OCC(C)(F)F)cn1 |
| InChI | InChI=1S/C15H16F2N2O3S/c1-3-23(20,21)13-5-4-8-18-14(13)12-7-6-11(9-19-12)22-10-15(2,16)17/h4-9H,3,10H2,1-2H3 |
| InChIKey | JINITLQZMTXAJF-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 69.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |