C14H12F5N3O4S — CID 129177644
3-(3-ethylsulfonyl-2-pyridinyl)-1-oxido-6-(2,2,3,3,3-pentafluoropropoxy)pyridazin-1-ium (PubChem CID 129177644) has the molecular formula C14H12F5N3O4S and a molecular weight of 413.32 g/mol. Its IUPAC name is 3-(3-ethylsulfonyl-2-pyridinyl)-1-oxido-6-(2,2,3,3,3-pentafluoropropoxy)pyridazin-1-ium.
| Compound Name | 3-(3-ethylsulfonyl-2-pyridinyl)-1-oxido-6-(2,2,3,3,3-pentafluoropropoxy)pyridazin-1-ium |
|---|---|
| PubChem CID | 129177644 |
| Molecular Formula | C14H12F5N3O4S |
| Molecular Weight | 413.32 g/mol |
| Exact Mass | 413.05 |
| IUPAC Name | 3-(3-ethylsulfonyl-2-pyridinyl)-1-oxido-6-(2,2,3,3,3-pentafluoropropoxy)pyridazin-1-ium |
| SMILES | CCS(=O)(=O)c1cccnc1-c1ccc(OCC(F)(F)C(F)(F)F)[n+]([O-])n1 |
| InChI | InChI=1S/C14H12F5N3O4S/c1-2-27(24,25)10-4-3-7-20-12(10)9-5-6-11(22(23)21-9)26-8-13(15,16)14(17,18)19/h3-7H,2,8H2,1H3 |
| InChIKey | LGEGRNZOEFFPIN-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 96.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.32 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|