C16H13F8N3O3S — CID 121264763
6-(3-ethylsulfonyl-2-pyridinyl)-3-(2,2,3,3,4,4,5,5-octafluoropentyl)pyrimidin-4-one (PubChem CID 121264763) has the molecular formula C16H13F8N3O3S and a molecular weight of 479.35 g/mol. Its IUPAC name is 6-(3-ethylsulfonyl-2-pyridinyl)-3-(2,2,3,3,4,4,5,5-octafluoropentyl)pyrimidin-4-one.
| Compound Name | 6-(3-ethylsulfonyl-2-pyridinyl)-3-(2,2,3,3,4,4,5,5-octafluoropentyl)pyrimidin-4-one |
|---|---|
| PubChem CID | 121264763 |
| Molecular Formula | C16H13F8N3O3S |
| Molecular Weight | 479.35 g/mol |
| Exact Mass | 479.05 |
| IUPAC Name | 6-(3-ethylsulfonyl-2-pyridinyl)-3-(2,2,3,3,4,4,5,5-octafluoropentyl)pyrimidin-4-one |
| SMILES | CCS(=O)(=O)c1cccnc1-c1cc(=O)n(CC(F)(F)C(F)(F)C(F)(F)C(F)F)cn1 |
| InChI | InChI=1S/C16H13F8N3O3S/c1-2-31(29,30)10-4-3-5-25-12(10)9-6-11(28)27(8-26-9)7-14(19,20)16(23,24)15(21,22)13(17)18/h3-6,8,13H,2,7H2,1H3 |
| InChIKey | GDQWALBSYBCIOR-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 81.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.35 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|