C15H15F6N3O2S2 — CID 138721523
6-(3-ethylsulfonyl-2-pyridinyl)-3-(2,2,3,4,4,4-hexafluorobutyl)-4H-pyrimidine-4-thiol (PubChem CID 138721523) has the molecular formula C15H15F6N3O2S2 and a molecular weight of 447.43 g/mol. Its IUPAC name is 6-(3-ethylsulfonyl-2-pyridinyl)-3-(2,2,3,4,4,4-hexafluorobutyl)-4H-pyrimidine-4-thiol.
| Compound Name | 6-(3-ethylsulfonyl-2-pyridinyl)-3-(2,2,3,4,4,4-hexafluorobutyl)-4H-pyrimidine-4-thiol |
|---|---|
| PubChem CID | 138721523 |
| Molecular Formula | C15H15F6N3O2S2 |
| Molecular Weight | 447.43 g/mol |
| Exact Mass | 447.05 |
| IUPAC Name | 6-(3-ethylsulfonyl-2-pyridinyl)-3-(2,2,3,4,4,4-hexafluorobutyl)-4H-pyrimidine-4-thiol |
| SMILES | CCS(=O)(=O)c1cccnc1C1=CC(S)N(CC(F)(F)C(F)C(F)(F)F)C=N1 |
| InChI | InChI=1S/C15H15F6N3O2S2/c1-2-28(25,26)10-4-3-5-22-12(10)9-6-11(27)24(8-23-9)7-14(17,18)13(16)15(19,20)21/h3-6,8,11,13,27H,2,7H2,1H3 |
| InChIKey | BKADANNKSAXDHK-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 62.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.43 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|