C13H12Cl3N3O3S — CID 129177650
3-(3-ethylsulfonyl-2-pyridinyl)-6-(2,2,2-trichloroethoxy)pyridazine (PubChem CID 129177650) has the molecular formula C13H12Cl3N3O3S and a molecular weight of 396.68 g/mol. Its IUPAC name is 3-(3-ethylsulfonyl-2-pyridinyl)-6-(2,2,2-trichloroethoxy)pyridazine.
| Compound Name | 3-(3-ethylsulfonyl-2-pyridinyl)-6-(2,2,2-trichloroethoxy)pyridazine |
|---|---|
| PubChem CID | 129177650 |
| Molecular Formula | C13H12Cl3N3O3S |
| Molecular Weight | 396.68 g/mol |
| Exact Mass | 394.97 |
| IUPAC Name | 3-(3-ethylsulfonyl-2-pyridinyl)-6-(2,2,2-trichloroethoxy)pyridazine |
| SMILES | CCS(=O)(=O)c1cccnc1-c1ccc(OCC(Cl)(Cl)Cl)nn1 |
| InChI | InChI=1S/C13H12Cl3N3O3S/c1-2-23(20,21)10-4-3-7-17-12(10)9-5-6-11(19-18-9)22-8-13(14,15)16/h3-7H,2,8H2,1H3 |
| InChIKey | IJGPYCUWYWFSGM-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 82.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.68 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|