C19H15F5N4O4S — CID 142364361
3-(3-ethylsulfonyl-5-pyridin-2-yloxy-2-pyridinyl)-6-(2,2,3,3,3-pentafluoropropoxy)pyridazine (PubChem CID 142364361) has the molecular formula C19H15F5N4O4S and a molecular weight of 490.41 g/mol. Its IUPAC name is 3-(3-ethylsulfonyl-5-pyridin-2-yloxy-2-pyridinyl)-6-(2,2,3,3,3-pentafluoropropoxy)pyridazine.
| Compound Name | 3-(3-ethylsulfonyl-5-pyridin-2-yloxy-2-pyridinyl)-6-(2,2,3,3,3-pentafluoropropoxy)pyridazine |
|---|---|
| PubChem CID | 142364361 |
| Molecular Formula | C19H15F5N4O4S |
| Molecular Weight | 490.41 g/mol |
| Exact Mass | 490.07 |
| IUPAC Name | 3-(3-ethylsulfonyl-5-pyridin-2-yloxy-2-pyridinyl)-6-(2,2,3,3,3-pentafluoropropoxy)pyridazine |
| SMILES | CCS(=O)(=O)c1cc(Oc2ccccn2)cnc1-c1ccc(OCC(F)(F)C(F)(F)F)nn1 |
| InChI | InChI=1S/C19H15F5N4O4S/c1-2-33(29,30)14-9-12(32-15-5-3-4-8-25-15)10-26-17(14)13-6-7-16(28-27-13)31-11-18(20,21)19(22,23)24/h3-10H,2,11H2,1H3 |
| InChIKey | FHTNSKQTJRUEOT-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 104.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.41 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|