C24H23F5N4O3S — CID 168854011
[1-[4-[5-ethylsulfonyl-6-[6-(2,2,3,3,3-pentafluoropropoxy)pyridazin-3-yl]-3-pyridinyl]phenyl]cyclopropyl]methanamine (PubChem CID 168854011) has the molecular formula C24H23F5N4O3S and a molecular weight of 542.53 g/mol. Its IUPAC name is [1-[4-[5-ethylsulfonyl-6-[6-(2,2,3,3,3-pentafluoropropoxy)pyridazin-3-yl]-3-pyridinyl]phenyl]cyclopropyl]methanamine.
| Compound Name | [1-[4-[5-ethylsulfonyl-6-[6-(2,2,3,3,3-pentafluoropropoxy)pyridazin-3-yl]-3-pyridinyl]phenyl]cyclopropyl]methanamine |
|---|---|
| PubChem CID | 168854011 |
| Molecular Formula | C24H23F5N4O3S |
| Molecular Weight | 542.53 g/mol |
| Exact Mass | 542.14 |
| IUPAC Name | [1-[4-[5-ethylsulfonyl-6-[6-(2,2,3,3,3-pentafluoropropoxy)pyridazin-3-yl]-3-pyridinyl]phenyl]cyclopropyl]methanamine |
| SMILES | CCS(=O)(=O)c1cc(-c2ccc(C3(CN)CC3)cc2)cnc1-c1ccc(OCC(F)(F)C(F)(F)F)nn1 |
| InChI | InChI=1S/C24H23F5N4O3S/c1-2-37(34,35)19-11-16(15-3-5-17(6-4-15)22(13-30)9-10-22)12-31-21(19)18-7-8-20(33-32-18)36-14-23(25,26)24(27,28)29/h3-8,11-12H,2,9-10,13-14,30H2,1H3 |
| InChIKey | PRWCQPQWFRMZJY-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 108.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.53 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|