C20H15F6N3O4S — CID 140928203
5-ethylsulfonyl-3-(4-fluorophenyl)-6-[5-(2,2,3,3,3-pentafluoropropoxy)pyrazin-2-yl]-1H-pyridin-2-one (PubChem CID 140928203) has the molecular formula C20H15F6N3O4S and a molecular weight of 507.41 g/mol. Its IUPAC name is 5-ethylsulfonyl-3-(4-fluorophenyl)-6-[5-(2,2,3,3,3-pentafluoropropoxy)pyrazin-2-yl]-1H-pyridin-2-one.
| Compound Name | 5-ethylsulfonyl-3-(4-fluorophenyl)-6-[5-(2,2,3,3,3-pentafluoropropoxy)pyrazin-2-yl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 140928203 |
| Molecular Formula | C20H15F6N3O4S |
| Molecular Weight | 507.41 g/mol |
| Exact Mass | 507.07 |
| IUPAC Name | 5-ethylsulfonyl-3-(4-fluorophenyl)-6-[5-(2,2,3,3,3-pentafluoropropoxy)pyrazin-2-yl]-1H-pyridin-2-one |
| SMILES | CCS(=O)(=O)c1cc(-c2ccc(F)cc2)c(=O)[nH]c1-c1cnc(OCC(F)(F)C(F)(F)F)cn1 |
| InChI | InChI=1S/C20H15F6N3O4S/c1-2-34(31,32)15-7-13(11-3-5-12(21)6-4-11)18(30)29-17(15)14-8-28-16(9-27-14)33-10-19(22,23)20(24,25)26/h3-9H,2,10H2,1H3,(H,29,30) |
| InChIKey | ZYRMYVNDJQNVPW-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.41 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|