C18H16F5N5O3S — CID 165394036
7-cyclopropyl-2-ethylsulfonyl-3-[5-(2,2,3,3,3-pentafluoropropoxy)pyrazin-2-yl]pyrazolo[1,5-a]pyrimidine (PubChem CID 165394036) has the molecular formula C18H16F5N5O3S and a molecular weight of 477.42 g/mol. Its IUPAC name is 7-cyclopropyl-2-ethylsulfonyl-3-[5-(2,2,3,3,3-pentafluoropropoxy)pyrazin-2-yl]pyrazolo[1,5-a]pyrimidine.
| Compound Name | 7-cyclopropyl-2-ethylsulfonyl-3-[5-(2,2,3,3,3-pentafluoropropoxy)pyrazin-2-yl]pyrazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 165394036 |
| Molecular Formula | C18H16F5N5O3S |
| Molecular Weight | 477.42 g/mol |
| Exact Mass | 477.09 |
| IUPAC Name | 7-cyclopropyl-2-ethylsulfonyl-3-[5-(2,2,3,3,3-pentafluoropropoxy)pyrazin-2-yl]pyrazolo[1,5-a]pyrimidine |
| SMILES | CCS(=O)(=O)c1nn2c(C3CC3)ccnc2c1-c1cnc(OCC(F)(F)C(F)(F)F)cn1 |
| InChI | InChI=1S/C18H16F5N5O3S/c1-2-32(29,30)16-14(15-24-6-5-12(10-3-4-10)28(15)27-16)11-7-26-13(8-25-11)31-9-17(19,20)18(21,22)23/h5-8,10H,2-4,9H2,1H3 |
| InChIKey | WCUNDSMPTZFWGD-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 99.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.42 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|