C21H15F6N5O3S — CID 165394090
2-ethylsulfonyl-7-(4-fluorophenyl)-3-[5-(2,2,3,3,3-pentafluoropropoxy)pyrazin-2-yl]pyrazolo[1,5-a]pyrimidine (PubChem CID 165394090) has the molecular formula C21H15F6N5O3S and a molecular weight of 531.44 g/mol. Its IUPAC name is 2-ethylsulfonyl-7-(4-fluorophenyl)-3-[5-(2,2,3,3,3-pentafluoropropoxy)pyrazin-2-yl]pyrazolo[1,5-a]pyrimidine.
| Compound Name | 2-ethylsulfonyl-7-(4-fluorophenyl)-3-[5-(2,2,3,3,3-pentafluoropropoxy)pyrazin-2-yl]pyrazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 165394090 |
| Molecular Formula | C21H15F6N5O3S |
| Molecular Weight | 531.44 g/mol |
| Exact Mass | 531.08 |
| IUPAC Name | 2-ethylsulfonyl-7-(4-fluorophenyl)-3-[5-(2,2,3,3,3-pentafluoropropoxy)pyrazin-2-yl]pyrazolo[1,5-a]pyrimidine |
| SMILES | CCS(=O)(=O)c1nn2c(-c3ccc(F)cc3)ccnc2c1-c1cnc(OCC(F)(F)C(F)(F)F)cn1 |
| InChI | InChI=1S/C21H15F6N5O3S/c1-2-36(33,34)19-17(14-9-30-16(10-29-14)35-11-20(23,24)21(25,26)27)18-28-8-7-15(32(18)31-19)12-3-5-13(22)6-4-12/h3-10H,2,11H2,1H3 |
| InChIKey | NHJNMZUINCQKJD-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 99.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.44 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|