C11H11F5N2O4S — CID 140928213
2-ethylsulfonyl-1-[5-(2,2,3,3,3-pentafluoropropoxy)pyrazin-2-yl]ethanone (PubChem CID 140928213) has the molecular formula C11H11F5N2O4S and a molecular weight of 362.28 g/mol. Its IUPAC name is 2-ethylsulfonyl-1-[5-(2,2,3,3,3-pentafluoropropoxy)pyrazin-2-yl]ethanone.
| Compound Name | 2-ethylsulfonyl-1-[5-(2,2,3,3,3-pentafluoropropoxy)pyrazin-2-yl]ethanone |
|---|---|
| PubChem CID | 140928213 |
| Molecular Formula | C11H11F5N2O4S |
| Molecular Weight | 362.28 g/mol |
| Exact Mass | 362.04 |
| IUPAC Name | 2-ethylsulfonyl-1-[5-(2,2,3,3,3-pentafluoropropoxy)pyrazin-2-yl]ethanone |
| SMILES | CCS(=O)(=O)CC(=O)c1cnc(OCC(F)(F)C(F)(F)F)cn1 |
| InChI | InChI=1S/C11H11F5N2O4S/c1-2-23(20,21)5-8(19)7-3-18-9(4-17-7)22-6-10(12,13)11(14,15)16/h3-4H,2,5-6H2,1H3 |
| InChIKey | VBIUIRDIUUOMBJ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 86.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.28 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|