C10H11F5N2O2 — CID 103241794
4-(2,2,3,3,3-pentafluoropropoxy)-2-propan-2-yl-1H-pyrimidin-6-one (PubChem CID 103241794) has the molecular formula C10H11F5N2O2 and a molecular weight of 286.20 g/mol. Its IUPAC name is 4-(2,2,3,3,3-pentafluoropropoxy)-2-propan-2-yl-1H-pyrimidin-6-one.
| Compound Name | 4-(2,2,3,3,3-pentafluoropropoxy)-2-propan-2-yl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 103241794 |
| Molecular Formula | C10H11F5N2O2 |
| Molecular Weight | 286.20 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | 4-(2,2,3,3,3-pentafluoropropoxy)-2-propan-2-yl-1H-pyrimidin-6-one |
| SMILES | CC(C)c1nc(OCC(F)(F)C(F)(F)F)cc(=O)[nH]1 |
| InChI | InChI=1S/C10H11F5N2O2/c1-5(2)8-16-6(18)3-7(17-8)19-4-9(11,12)10(13,14)15/h3,5H,4H2,1-2H3,(H,16,17,18) |
| InChIKey | OKFZQRYRHVXRIA-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.20 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|