5-(2,2-difluoroethoxy)pyrazine-2-carbonyl chloride

C7H5ClF2N2O2 — CID 121268136

IUPAC5-(2,2-difluoroethoxy)pyrazine-2-carbonyl chloride
SMILESO=C(Cl)c1cnc(OCC(F)F)cn1
InChIInChI=1S/C7H5ClF2N2O2/c8-7(13)4-1-12-6(2-11-4)14-3-5(9)10/h1-2,5H,3H2
InChIKeyYMPDXOSWMXOXAF-UHFFFAOYSA-N
MW222.58 g/mol
LogP1.50
Rot. Bonds4

About 5-(2,2-difluoroethoxy)pyrazine-2-carbonyl chloride

5-(2,2-difluoroethoxy)pyrazine-2-carbonyl chloride (PubChem CID 121268136) has the molecular formula C7H5ClF2N2O2 and a molecular weight of 222.58 g/mol. Its IUPAC name is 5-(2,2-difluoroethoxy)pyrazine-2-carbonyl chloride.

Molecular Properties

Compound Name5-(2,2-difluoroethoxy)pyrazine-2-carbonyl chloride
PubChem CID121268136
Molecular FormulaC7H5ClF2N2O2
Molecular Weight222.58 g/mol
Exact Mass222.00
IUPAC Name5-(2,2-difluoroethoxy)pyrazine-2-carbonyl chloride
SMILESO=C(Cl)c1cnc(OCC(F)F)cn1
InChIInChI=1S/C7H5ClF2N2O2/c8-7(13)4-1-12-6(2-11-4)14-3-5(9)10/h1-2,5H,3H2
InChIKeyYMPDXOSWMXOXAF-UHFFFAOYSA-N
XLogP1.50
TPSA52.08 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500222.58
LogP ≤ 51.50
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 5-(2,2-difluoroethoxy)pyrazine-2-carbonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(2,2-difluoroethoxy)pyrazine-2-carbonyl chloride?
The IUPAC name of 5-(2,2-difluoroethoxy)pyrazine-2-carbonyl chloride (CID 121268136) is 5-(2,2-difluoroethoxy)pyrazine-2-carbonyl chloride.
What is the SMILES notation for 5-(2,2-difluoroethoxy)pyrazine-2-carbonyl chloride?
The canonical SMILES for 5-(2,2-difluoroethoxy)pyrazine-2-carbonyl chloride is O=C(Cl)c1cnc(OCC(F)F)cn1.
What is the InChIKey of 5-(2,2-difluoroethoxy)pyrazine-2-carbonyl chloride?
The InChIKey is YMPDXOSWMXOXAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5ClF2N2O2/c8-7(13)4-1-12-6(2-11-4)14-3-5(9)10/h1-2,5H,3H2.
What are the key properties of 5-(2,2-difluoroethoxy)pyrazine-2-carbonyl chloride?
5-(2,2-difluoroethoxy)pyrazine-2-carbonyl chloride has a molecular weight of 222.58 g/mol, XLogP of 1.50, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,2-difluoroethoxy)pyrazine-2-carbonyl chloride is sourced from PubChem (CID 121268136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).