C7H5ClF2N2O2 — CID 121268136
5-(2,2-difluoroethoxy)pyrazine-2-carbonyl chloride (PubChem CID 121268136) has the molecular formula C7H5ClF2N2O2 and a molecular weight of 222.58 g/mol. Its IUPAC name is 5-(2,2-difluoroethoxy)pyrazine-2-carbonyl chloride.
| Compound Name | 5-(2,2-difluoroethoxy)pyrazine-2-carbonyl chloride |
|---|---|
| PubChem CID | 121268136 |
| Molecular Formula | C7H5ClF2N2O2 |
| Molecular Weight | 222.58 g/mol |
| Exact Mass | 222.00 |
| IUPAC Name | 5-(2,2-difluoroethoxy)pyrazine-2-carbonyl chloride |
| SMILES | O=C(Cl)c1cnc(OCC(F)F)cn1 |
| InChI | InChI=1S/C7H5ClF2N2O2/c8-7(13)4-1-12-6(2-11-4)14-3-5(9)10/h1-2,5H,3H2 |
| InChIKey | YMPDXOSWMXOXAF-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.58 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|