C11H14F2N2OSi — CID 58303305
2-[5-(2,2-difluoroethoxy)pyrazin-2-yl]ethynyl-trimethylsilane (PubChem CID 58303305) has the molecular formula C11H14F2N2OSi and a molecular weight of 256.33 g/mol. Its IUPAC name is 2-[5-(2,2-difluoroethoxy)pyrazin-2-yl]ethynyl-trimethylsilane.
| Compound Name | 2-[5-(2,2-difluoroethoxy)pyrazin-2-yl]ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 58303305 |
| Molecular Formula | C11H14F2N2OSi |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 2-[5-(2,2-difluoroethoxy)pyrazin-2-yl]ethynyl-trimethylsilane |
| SMILES | C[Si](C)(C)C#Cc1cnc(OCC(F)F)cn1 |
| InChI | InChI=1S/C11H14F2N2OSi/c1-17(2,3)5-4-9-6-15-11(7-14-9)16-8-10(12)13/h6-7,10H,8H2,1-3H3 |
| InChIKey | BPRLBNXXYATHMG-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|