C18H20F2N6O3S2 — CID 123916988
N-[2-(2-amino-6-methyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-8a-yl)-1,3-thiazol-4-yl]-5-(2,2-difluoroethoxy)pyrazine-2-carboxamide (PubChem CID 123916988) has the molecular formula C18H20F2N6O3S2 and a molecular weight of 470.53 g/mol. Its IUPAC name is N-[2-(2-amino-6-methyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-8a-yl)-1,3-thiazol-4-yl]-5-(2,2-difluoroethoxy)pyrazine-2-carboxamide.
| Compound Name | N-[2-(2-amino-6-methyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-8a-yl)-1,3-thiazol-4-yl]-5-(2,2-difluoroethoxy)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 123916988 |
| Molecular Formula | C18H20F2N6O3S2 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.10 |
| IUPAC Name | N-[2-(2-amino-6-methyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-8a-yl)-1,3-thiazol-4-yl]-5-(2,2-difluoroethoxy)pyrazine-2-carboxamide |
| SMILES | CC1CC2CSC(N)=NC2(c2nc(NC(=O)c3cnc(OCC(F)F)cn3)cs2)CO1 |
| InChI | InChI=1S/C18H20F2N6O3S2/c1-9-2-10-6-31-17(21)26-18(10,8-29-9)16-25-13(7-30-16)24-15(27)11-3-23-14(4-22-11)28-5-12(19)20/h3-4,7,9-10,12H,2,5-6,8H2,1H3,(H2,21,26)(H,24,27) |
| InChIKey | MTELPMJTUUXMHL-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 124.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |