C17H18F2N6O3S2 — CID 118435630
N-[2-[(4aR,6S)-2-amino-6-methyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-8a-yl]-1,3-thiazol-4-yl]-5-(difluoromethoxy)pyrimidine-2-carboxamide (PubChem CID 118435630) has the molecular formula C17H18F2N6O3S2 and a molecular weight of 456.50 g/mol. Its IUPAC name is N-[2-[(4aR,6S)-2-amino-6-methyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-8a-yl]-1,3-thiazol-4-yl]-5-(difluoromethoxy)pyrimidine-2-carboxamide.
| Compound Name | N-[2-[(4aR,6S)-2-amino-6-methyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-8a-yl]-1,3-thiazol-4-yl]-5-(difluoromethoxy)pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 118435630 |
| Molecular Formula | C17H18F2N6O3S2 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.08 |
| IUPAC Name | N-[2-[(4aR,6S)-2-amino-6-methyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-8a-yl]-1,3-thiazol-4-yl]-5-(difluoromethoxy)pyrimidine-2-carboxamide |
| SMILES | C[C@H]1C[C@H]2CSC(N)=NC2(c2nc(NC(=O)c3ncc(OC(F)F)cn3)cs2)CO1 |
| InChI | InChI=1S/C17H18F2N6O3S2/c1-8-2-9-5-30-16(20)25-17(9,7-27-8)14-24-11(6-29-14)23-13(26)12-21-3-10(4-22-12)28-15(18)19/h3-4,6,8-9,15H,2,5,7H2,1H3,(H2,20,25)(H,23,26)/t8-,9-,17?/m0/s1 |
| InChIKey | FIYXMKDQPHXQOF-OPAWEFCTSA-N |
| XLogP | 2.47 |
| TPSA | 124.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |