C17H20F2N6O2S2 — CID 118435579
N-[2-[(4aR,6S)-2-amino-6-methyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-8a-yl]-1,3-thiazol-4-yl]-1-(2,2-difluoroethyl)pyrazole-3-carboxamide (PubChem CID 118435579) has the molecular formula C17H20F2N6O2S2 and a molecular weight of 442.52 g/mol. Its IUPAC name is N-[2-[(4aR,6S)-2-amino-6-methyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-8a-yl]-1,3-thiazol-4-yl]-1-(2,2-difluoroethyl)pyrazole-3-carboxamide.
| Compound Name | N-[2-[(4aR,6S)-2-amino-6-methyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-8a-yl]-1,3-thiazol-4-yl]-1-(2,2-difluoroethyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 118435579 |
| Molecular Formula | C17H20F2N6O2S2 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | N-[2-[(4aR,6S)-2-amino-6-methyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-8a-yl]-1,3-thiazol-4-yl]-1-(2,2-difluoroethyl)pyrazole-3-carboxamide |
| SMILES | C[C@H]1C[C@H]2CSC(N)=NC2(c2nc(NC(=O)c3ccn(CC(F)F)n3)cs2)CO1 |
| InChI | InChI=1S/C17H20F2N6O2S2/c1-9-4-10-6-29-16(20)23-17(10,8-27-9)15-22-13(7-28-15)21-14(26)11-2-3-25(24-11)5-12(18)19/h2-3,7,9-10,12H,4-6,8H2,1H3,(H2,20,23)(H,21,26)/t9-,10-,17?/m0/s1 |
| InChIKey | VLPCCGAGIGLCDG-IUPUIGEKSA-N |
| XLogP | 2.54 |
| TPSA | 107.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |