C16H18N6O2S2 — CID 118435620
N-[2-[(4aR,6S,8aR)-2-amino-6-methyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-8a-yl]-1,3-thiazol-4-yl]pyridazine-3-carboxamide (PubChem CID 118435620) has the molecular formula C16H18N6O2S2 and a molecular weight of 390.49 g/mol. Its IUPAC name is N-[2-[(4aR,6S,8aR)-2-amino-6-methyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-8a-yl]-1,3-thiazol-4-yl]pyridazine-3-carboxamide.
| Compound Name | N-[2-[(4aR,6S,8aR)-2-amino-6-methyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-8a-yl]-1,3-thiazol-4-yl]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 118435620 |
| Molecular Formula | C16H18N6O2S2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | N-[2-[(4aR,6S,8aR)-2-amino-6-methyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-8a-yl]-1,3-thiazol-4-yl]pyridazine-3-carboxamide |
| SMILES | C[C@H]1C[C@H]2CSC(N)=N[C@@]2(c2nc(NC(=O)c3cccnn3)cs2)CO1 |
| InChI | InChI=1S/C16H18N6O2S2/c1-9-5-10-6-26-15(17)21-16(10,8-24-9)14-20-12(7-25-14)19-13(23)11-3-2-4-18-22-11/h2-4,7,9-10H,5-6,8H2,1H3,(H2,17,21)(H,19,23)/t9-,10-,16-/m0/s1 |
| InChIKey | KQUUSQLBNZEBSG-PUTJDCORSA-N |
| XLogP | 1.87 |
| TPSA | 115.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |