C16H20N6O2S2 — CID 123946136
N-[2-(2-amino-6-methyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-8a-yl)-1,3-thiazol-4-yl]-1-methylimidazole-4-carboxamide (PubChem CID 123946136) has the molecular formula C16H20N6O2S2 and a molecular weight of 392.51 g/mol. Its IUPAC name is N-[2-(2-amino-6-methyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-8a-yl)-1,3-thiazol-4-yl]-1-methylimidazole-4-carboxamide.
| Compound Name | N-[2-(2-amino-6-methyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-8a-yl)-1,3-thiazol-4-yl]-1-methylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 123946136 |
| Molecular Formula | C16H20N6O2S2 |
| Molecular Weight | 392.51 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | N-[2-(2-amino-6-methyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-8a-yl)-1,3-thiazol-4-yl]-1-methylimidazole-4-carboxamide |
| SMILES | CC1CC2CSC(N)=NC2(c2nc(NC(=O)c3cn(C)cn3)cs2)CO1 |
| InChI | InChI=1S/C16H20N6O2S2/c1-9-3-10-5-26-15(17)21-16(10,7-24-9)14-20-12(6-25-14)19-13(23)11-4-22(2)8-18-11/h4,6,8-10H,3,5,7H2,1-2H3,(H2,17,21)(H,19,23) |
| InChIKey | NPGXSCFUAULWBJ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 107.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.51 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |