C20H26N6O2S2 — CID 123455847
N-[2-(2-amino-6-methyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-8a-yl)-1,3-thiazol-4-yl]-3-cyclobutyl-1-methylpyrazole-5-carboxamide (PubChem CID 123455847) has the molecular formula C20H26N6O2S2 and a molecular weight of 446.60 g/mol. Its IUPAC name is N-[2-(2-amino-6-methyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-8a-yl)-1,3-thiazol-4-yl]-3-cyclobutyl-1-methylpyrazole-5-carboxamide.
| Compound Name | N-[2-(2-amino-6-methyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-8a-yl)-1,3-thiazol-4-yl]-3-cyclobutyl-1-methylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 123455847 |
| Molecular Formula | C20H26N6O2S2 |
| Molecular Weight | 446.60 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | N-[2-(2-amino-6-methyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-8a-yl)-1,3-thiazol-4-yl]-3-cyclobutyl-1-methylpyrazole-5-carboxamide |
| SMILES | CC1CC2CSC(N)=NC2(c2nc(NC(=O)c3cc(C4CCC4)nn3C)cs2)CO1 |
| InChI | InChI=1S/C20H26N6O2S2/c1-11-6-13-8-30-19(21)24-20(13,10-28-11)18-23-16(9-29-18)22-17(27)15-7-14(25-26(15)2)12-4-3-5-12/h7,9,11-13H,3-6,8,10H2,1-2H3,(H2,21,24)(H,22,27) |
| InChIKey | SSQFRZCBPFEOAS-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 107.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.60 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |