C24H27F3NO3PS — CID 142820889
[difluoro-[3-(4-fluorophenyl)-4-(4-methylsulfonylphenyl)-6-propoxy-2-pyridinyl]methyl]phosphane;ethane (PubChem CID 142820889) has the molecular formula C24H27F3NO3PS and a molecular weight of 497.52 g/mol. Its IUPAC name is [difluoro-[3-(4-fluorophenyl)-4-(4-methylsulfonylphenyl)-6-propoxy-2-pyridinyl]methyl]phosphane;ethane.
| Compound Name | [difluoro-[3-(4-fluorophenyl)-4-(4-methylsulfonylphenyl)-6-propoxy-2-pyridinyl]methyl]phosphane;ethane |
|---|---|
| PubChem CID | 142820889 |
| Molecular Formula | C24H27F3NO3PS |
| Molecular Weight | 497.52 g/mol |
| Exact Mass | 497.14 |
| IUPAC Name | [difluoro-[3-(4-fluorophenyl)-4-(4-methylsulfonylphenyl)-6-propoxy-2-pyridinyl]methyl]phosphane;ethane |
| SMILES | CC.CCCOc1cc(-c2ccc(S(C)(=O)=O)cc2)c(-c2ccc(F)cc2)c(C(F)(F)P)n1 |
| InChI | InChI=1S/C22H21F3NO3PS.C2H6/c1-3-12-29-19-13-18(14-6-10-17(11-7-14)31(2,27)28)20(21(26-19)22(24,25)30)15-4-8-16(23)9-5-15;1-2/h4-11,13H,3,12,30H2,1-2H3;1-2H3 |
| InChIKey | OWOMBAZSVCIVOX-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.52 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|