C21H29NO6S — CID 164623216
1-[[6-butoxy-5-(hydroxymethyl)-3-(4-methylsulfonylphenyl)-2-pyridinyl]oxy]-2-methylpropan-2-ol (PubChem CID 164623216) has the molecular formula C21H29NO6S and a molecular weight of 423.53 g/mol. Its IUPAC name is 1-[[6-butoxy-5-(hydroxymethyl)-3-(4-methylsulfonylphenyl)-2-pyridinyl]oxy]-2-methylpropan-2-ol.
| Compound Name | 1-[[6-butoxy-5-(hydroxymethyl)-3-(4-methylsulfonylphenyl)-2-pyridinyl]oxy]-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 164623216 |
| Molecular Formula | C21H29NO6S |
| Molecular Weight | 423.53 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | 1-[[6-butoxy-5-(hydroxymethyl)-3-(4-methylsulfonylphenyl)-2-pyridinyl]oxy]-2-methylpropan-2-ol |
| SMILES | CCCCOc1nc(OCC(C)(C)O)c(-c2ccc(S(C)(=O)=O)cc2)cc1CO |
| InChI | InChI=1S/C21H29NO6S/c1-5-6-11-27-19-16(13-23)12-18(20(22-19)28-14-21(2,3)24)15-7-9-17(10-8-15)29(4,25)26/h7-10,12,23-24H,5-6,11,13-14H2,1-4H3 |
| InChIKey | AOZDPSPDZPRLTR-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 105.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.53 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|