C21H22N2O5S — CID 171691982
5-(4-butoxyphenyl)-N-(4-methylsulfonylphenyl)-1,2-oxazole-3-carboxamide (PubChem CID 171691982) has the molecular formula C21H22N2O5S and a molecular weight of 414.48 g/mol. Its IUPAC name is 5-(4-butoxyphenyl)-N-(4-methylsulfonylphenyl)-1,2-oxazole-3-carboxamide.
| Compound Name | 5-(4-butoxyphenyl)-N-(4-methylsulfonylphenyl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 171691982 |
| Molecular Formula | C21H22N2O5S |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | 5-(4-butoxyphenyl)-N-(4-methylsulfonylphenyl)-1,2-oxazole-3-carboxamide |
| SMILES | CCCCOc1ccc(-c2cc(C(=O)Nc3ccc(S(C)(=O)=O)cc3)no2)cc1 |
| InChI | InChI=1S/C21H22N2O5S/c1-3-4-13-27-17-9-5-15(6-10-17)20-14-19(23-28-20)21(24)22-16-7-11-18(12-8-16)29(2,25)26/h5-12,14H,3-4,13H2,1-2H3,(H,22,24) |
| InChIKey | BEYNPICURYAVHV-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|