C23H19N3O4S — CID 17011046
N-[4-[methyl(phenyl)sulfamoyl]phenyl]-5-phenyl-1,2-oxazole-3-carboxamide (PubChem CID 17011046) has the molecular formula C23H19N3O4S and a molecular weight of 433.49 g/mol. Its IUPAC name is N-[4-[methyl(phenyl)sulfamoyl]phenyl]-5-phenyl-1,2-oxazole-3-carboxamide.
| Compound Name | N-[4-[methyl(phenyl)sulfamoyl]phenyl]-5-phenyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 17011046 |
| Molecular Formula | C23H19N3O4S |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | N-[4-[methyl(phenyl)sulfamoyl]phenyl]-5-phenyl-1,2-oxazole-3-carboxamide |
| SMILES | CN(c1ccccc1)S(=O)(=O)c1ccc(NC(=O)c2cc(-c3ccccc3)on2)cc1 |
| InChI | InChI=1S/C23H19N3O4S/c1-26(19-10-6-3-7-11-19)31(28,29)20-14-12-18(13-15-20)24-23(27)21-16-22(30-25-21)17-8-4-2-5-9-17/h2-16H,1H3,(H,24,27) |
| InChIKey | ZRGLWQDWBUHDMU-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |