C20H18BrN3O5 — CID 52904514
N-(2-bromo-4-nitrophenyl)-5-(4-butoxyphenyl)-1,2-oxazole-3-carboxamide (PubChem CID 52904514) has the molecular formula C20H18BrN3O5 and a molecular weight of 460.28 g/mol. Its IUPAC name is N-(2-bromo-4-nitrophenyl)-5-(4-butoxyphenyl)-1,2-oxazole-3-carboxamide.
| Compound Name | N-(2-bromo-4-nitrophenyl)-5-(4-butoxyphenyl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 52904514 |
| Molecular Formula | C20H18BrN3O5 |
| Molecular Weight | 460.28 g/mol |
| Exact Mass | 459.04 |
| IUPAC Name | N-(2-bromo-4-nitrophenyl)-5-(4-butoxyphenyl)-1,2-oxazole-3-carboxamide |
| SMILES | CCCCOc1ccc(-c2cc(C(=O)Nc3ccc([N+](=O)[O-])cc3Br)no2)cc1 |
| InChI | InChI=1S/C20H18BrN3O5/c1-2-3-10-28-15-7-4-13(5-8-15)19-12-18(23-29-19)20(25)22-17-9-6-14(24(26)27)11-16(17)21/h4-9,11-12H,2-3,10H2,1H3,(H,22,25) |
| InChIKey | FHMMBMIGPHCLQH-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 107.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.28 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|