C28H32FNO5S — CID 54169082
5-[2-butoxy-6-(4-fluorophenyl)-5-(4-methylsulfonylphenyl)-3-pyridinyl]hexanoic acid (PubChem CID 54169082) has the molecular formula C28H32FNO5S and a molecular weight of 513.63 g/mol. Its IUPAC name is 5-[2-butoxy-6-(4-fluorophenyl)-5-(4-methylsulfonylphenyl)-3-pyridinyl]hexanoic acid.
| Compound Name | 5-[2-butoxy-6-(4-fluorophenyl)-5-(4-methylsulfonylphenyl)-3-pyridinyl]hexanoic acid |
|---|---|
| PubChem CID | 54169082 |
| Molecular Formula | C28H32FNO5S |
| Molecular Weight | 513.63 g/mol |
| Exact Mass | 513.20 |
| IUPAC Name | 5-[2-butoxy-6-(4-fluorophenyl)-5-(4-methylsulfonylphenyl)-3-pyridinyl]hexanoic acid |
| SMILES | CCCCOc1nc(-c2ccc(F)cc2)c(-c2ccc(S(C)(=O)=O)cc2)cc1C(C)CCCC(=O)O |
| InChI | InChI=1S/C28H32FNO5S/c1-4-5-17-35-28-24(19(2)7-6-8-26(31)32)18-25(20-11-15-23(16-12-20)36(3,33)34)27(30-28)21-9-13-22(29)14-10-21/h9-16,18-19H,4-8,17H2,1-3H3,(H,31,32) |
| InChIKey | OTTBOTRIZIOGMB-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 93.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.63 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|