C24H21FN2O3S — CID 70273625
6-(4-fluorophenyl)-5-(4-methylsulfonylphenyl)-2-pent-2-en-3-yloxypyridine-3-carbonitrile (PubChem CID 70273625) has the molecular formula C24H21FN2O3S and a molecular weight of 436.51 g/mol. Its IUPAC name is 6-(4-fluorophenyl)-5-(4-methylsulfonylphenyl)-2-pent-2-en-3-yloxypyridine-3-carbonitrile.
| Compound Name | 6-(4-fluorophenyl)-5-(4-methylsulfonylphenyl)-2-pent-2-en-3-yloxypyridine-3-carbonitrile |
|---|---|
| PubChem CID | 70273625 |
| Molecular Formula | C24H21FN2O3S |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | 6-(4-fluorophenyl)-5-(4-methylsulfonylphenyl)-2-pent-2-en-3-yloxypyridine-3-carbonitrile |
| SMILES | CC=C(CC)Oc1nc(-c2ccc(F)cc2)c(-c2ccc(S(C)(=O)=O)cc2)cc1C#N |
| InChI | InChI=1S/C24H21FN2O3S/c1-4-20(5-2)30-24-18(15-26)14-22(16-8-12-21(13-9-16)31(3,28)29)23(27-24)17-6-10-19(25)11-7-17/h4,6-14H,5H2,1-3H3 |
| InChIKey | TURKLLIBMOMDSG-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 80.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|