C22H21FN2O3S — CID 143049750
ethane;6-(4-fluorophenyl)-2-methoxy-5-(4-methylsulfonylphenyl)pyridine-3-carbonitrile (PubChem CID 143049750) has the molecular formula C22H21FN2O3S and a molecular weight of 412.49 g/mol. Its IUPAC name is ethane;6-(4-fluorophenyl)-2-methoxy-5-(4-methylsulfonylphenyl)pyridine-3-carbonitrile.
| Compound Name | ethane;6-(4-fluorophenyl)-2-methoxy-5-(4-methylsulfonylphenyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 143049750 |
| Molecular Formula | C22H21FN2O3S |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | ethane;6-(4-fluorophenyl)-2-methoxy-5-(4-methylsulfonylphenyl)pyridine-3-carbonitrile |
| SMILES | CC.COc1nc(-c2ccc(F)cc2)c(-c2ccc(S(C)(=O)=O)cc2)cc1C#N |
| InChI | InChI=1S/C20H15FN2O3S.C2H6/c1-26-20-15(12-22)11-18(13-5-9-17(10-6-13)27(2,24)25)19(23-20)14-3-7-16(21)8-4-14;1-2/h3-11H,1-2H3;1-2H3 |
| InChIKey | BKRUGSGVJFYKIL-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 80.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |