C26H29FN2O5S — CID 57112134
[2-butoxy-6-(4-fluorophenyl)-5-(4-sulfamoylphenyl)-3-pyridinyl] pentanoate (PubChem CID 57112134) has the molecular formula C26H29FN2O5S and a molecular weight of 500.59 g/mol. Its IUPAC name is [2-butoxy-6-(4-fluorophenyl)-5-(4-sulfamoylphenyl)-3-pyridinyl] pentanoate.
| Compound Name | [2-butoxy-6-(4-fluorophenyl)-5-(4-sulfamoylphenyl)-3-pyridinyl] pentanoate |
|---|---|
| PubChem CID | 57112134 |
| Molecular Formula | C26H29FN2O5S |
| Molecular Weight | 500.59 g/mol |
| Exact Mass | 500.18 |
| IUPAC Name | [2-butoxy-6-(4-fluorophenyl)-5-(4-sulfamoylphenyl)-3-pyridinyl] pentanoate |
| SMILES | CCCCOc1nc(-c2ccc(F)cc2)c(-c2ccc(S(N)(=O)=O)cc2)cc1OC(=O)CCCC |
| InChI | InChI=1S/C26H29FN2O5S/c1-3-5-7-24(30)34-23-17-22(18-10-14-21(15-11-18)35(28,31)32)25(19-8-12-20(27)13-9-19)29-26(23)33-16-6-4-2/h8-15,17H,3-7,16H2,1-2H3,(H2,28,31,32) |
| InChIKey | GGBGNAZIXHMZJY-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 108.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.59 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|