About 10-O-(2-bromo-4-fluorophenyl) 1-O-butyl decanedioate
10-O-(2-bromo-4-fluorophenyl) 1-O-butyl decanedioate (PubChem CID 91737783) has the molecular formula C20H28BrFO4
and a molecular weight of 431.34 g/mol. Its IUPAC name is 10-O-(2-bromo-4-fluorophenyl) 1-O-butyl decanedioate.
Molecular Properties
| Compound Name | 10-O-(2-bromo-4-fluorophenyl) 1-O-butyl decanedioate |
| PubChem CID | 91737783 |
| Molecular Formula | C20H28BrFO4 |
| Molecular Weight | 431.34 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | 10-O-(2-bromo-4-fluorophenyl) 1-O-butyl decanedioate |
| SMILES | CCCCOC(=O)CCCCCCCCC(=O)Oc1ccc(F)cc1Br |
| InChI | InChI=1S/C20H28BrFO4/c1-2-3-14-25-19(23)10-8-6-4-5-7-9-11-20(24)26-18-13-12-16(22)15-17(18)21/h12-13,15H,2-11,14H2,1H3 |
| InChIKey | LDMZQYFZLNFBKO-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 431.34 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 10-O-(2-bromo-4-fluorophenyl) 1-O-butyl decanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-O-(2-bromo-4-fluorophenyl) 1-O-butyl decanedioate?
The IUPAC name of 10-O-(2-bromo-4-fluorophenyl) 1-O-butyl decanedioate (CID 91737783) is 10-O-(2-bromo-4-fluorophenyl) 1-O-butyl decanedioate.
What is the SMILES notation for 10-O-(2-bromo-4-fluorophenyl) 1-O-butyl decanedioate?
The canonical SMILES for 10-O-(2-bromo-4-fluorophenyl) 1-O-butyl decanedioate is CCCCOC(=O)CCCCCCCCC(=O)Oc1ccc(F)cc1Br.
What is the InChIKey of 10-O-(2-bromo-4-fluorophenyl) 1-O-butyl decanedioate?
The InChIKey is LDMZQYFZLNFBKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H28BrFO4/c1-2-3-14-25-19(23)10-8-6-4-5-7-9-11-20(24)26-18-13-12-16(22)15-17(18)21/h12-13,15H,2-11,14H2,1H3.
What are the key properties of 10-O-(2-bromo-4-fluorophenyl) 1-O-butyl decanedioate?
10-O-(2-bromo-4-fluorophenyl) 1-O-butyl decanedioate has a molecular weight of 431.34 g/mol, XLogP of 5.96, 13 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 10-O-(2-bromo-4-fluorophenyl) 1-O-butyl decanedioate is sourced from PubChem (CID 91737783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).