C19H18BrFO4 — CID 6424057
2-O-(2-bromo-4-fluorophenyl) 1-O-pentyl benzene-1,2-dicarboxylate (PubChem CID 6424057) has the molecular formula C19H18BrFO4 and a molecular weight of 409.25 g/mol. Its IUPAC name is 2-O-(2-bromo-4-fluorophenyl) 1-O-pentyl benzene-1,2-dicarboxylate.
| Compound Name | 2-O-(2-bromo-4-fluorophenyl) 1-O-pentyl benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 6424057 |
| Molecular Formula | C19H18BrFO4 |
| Molecular Weight | 409.25 g/mol |
| Exact Mass | 408.04 |
| IUPAC Name | 2-O-(2-bromo-4-fluorophenyl) 1-O-pentyl benzene-1,2-dicarboxylate |
| SMILES | CCCCCOC(=O)c1ccccc1C(=O)Oc1ccc(F)cc1Br |
| InChI | InChI=1S/C19H18BrFO4/c1-2-3-6-11-24-18(22)14-7-4-5-8-15(14)19(23)25-17-10-9-13(21)12-16(17)20/h4-5,7-10,12H,2-3,6,11H2,1H3 |
| InChIKey | PNQXILMQSARIOS-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.25 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|