C19H20F3NO4S2 — CID 18797540
O-[3-(4-methylsulfonylphenyl)-5-(trifluoromethyl)-2-pyridinyl] 2-ethyl-2-hydroxybutanethioate (PubChem CID 18797540) has the molecular formula C19H20F3NO4S2 and a molecular weight of 447.50 g/mol. Its IUPAC name is O-[3-(4-methylsulfonylphenyl)-5-(trifluoromethyl)-2-pyridinyl] 2-ethyl-2-hydroxybutanethioate.
| Compound Name | O-[3-(4-methylsulfonylphenyl)-5-(trifluoromethyl)-2-pyridinyl] 2-ethyl-2-hydroxybutanethioate |
|---|---|
| PubChem CID | 18797540 |
| Molecular Formula | C19H20F3NO4S2 |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 447.08 |
| IUPAC Name | O-[3-(4-methylsulfonylphenyl)-5-(trifluoromethyl)-2-pyridinyl] 2-ethyl-2-hydroxybutanethioate |
| SMILES | CCC(O)(CC)C(=S)Oc1ncc(C(F)(F)F)cc1-c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C19H20F3NO4S2/c1-4-18(24,5-2)17(28)27-16-15(10-13(11-23-16)19(20,21)22)12-6-8-14(9-7-12)29(3,25)26/h6-11,24H,4-5H2,1-3H3 |
| InChIKey | YHSSZMCBYARXTA-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|