C20H24F3NO4S — CID 18797539
3-ethyl-1-[[3-(3-methylsulfonylphenyl)-5-(trifluoromethyl)-2-pyridinyl]oxy]pentan-3-ol (PubChem CID 18797539) has the molecular formula C20H24F3NO4S and a molecular weight of 431.48 g/mol. Its IUPAC name is 3-ethyl-1-[[3-(3-methylsulfonylphenyl)-5-(trifluoromethyl)-2-pyridinyl]oxy]pentan-3-ol.
| Compound Name | 3-ethyl-1-[[3-(3-methylsulfonylphenyl)-5-(trifluoromethyl)-2-pyridinyl]oxy]pentan-3-ol |
|---|---|
| PubChem CID | 18797539 |
| Molecular Formula | C20H24F3NO4S |
| Molecular Weight | 431.48 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | 3-ethyl-1-[[3-(3-methylsulfonylphenyl)-5-(trifluoromethyl)-2-pyridinyl]oxy]pentan-3-ol |
| SMILES | CCC(O)(CC)CCOc1ncc(C(F)(F)F)cc1-c1cccc(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C20H24F3NO4S/c1-4-19(25,5-2)9-10-28-18-17(12-15(13-24-18)20(21,22)23)14-7-6-8-16(11-14)29(3,26)27/h6-8,11-13,25H,4-5,9-10H2,1-3H3 |
| InChIKey | DQCHGRVXJFNDFO-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.48 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |