C19H20F3NO5S — CID 18797524
4-[[3-(3-methylsulfonylphenyl)-5-(trifluoromethyl)-2-pyridinyl]oxy]butan-2-yl acetate (PubChem CID 18797524) has the molecular formula C19H20F3NO5S and a molecular weight of 431.43 g/mol. Its IUPAC name is 4-[[3-(3-methylsulfonylphenyl)-5-(trifluoromethyl)-2-pyridinyl]oxy]butan-2-yl acetate.
| Compound Name | 4-[[3-(3-methylsulfonylphenyl)-5-(trifluoromethyl)-2-pyridinyl]oxy]butan-2-yl acetate |
|---|---|
| PubChem CID | 18797524 |
| Molecular Formula | C19H20F3NO5S |
| Molecular Weight | 431.43 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | 4-[[3-(3-methylsulfonylphenyl)-5-(trifluoromethyl)-2-pyridinyl]oxy]butan-2-yl acetate |
| SMILES | CC(=O)OC(C)CCOc1ncc(C(F)(F)F)cc1-c1cccc(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C19H20F3NO5S/c1-12(28-13(2)24)7-8-27-18-17(10-15(11-23-18)19(20,21)22)14-5-4-6-16(9-14)29(3,25)26/h4-6,9-12H,7-8H2,1-3H3 |
| InChIKey | XPKSPHAUUUMJMN-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 82.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.43 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |