C11H11ClF3NO5S — CID 126662223
1-[[3-chlorosulfonyl-5-(trifluoromethyl)-2-pyridinyl]oxy]propan-2-yl acetate (PubChem CID 126662223) has the molecular formula C11H11ClF3NO5S and a molecular weight of 361.73 g/mol. Its IUPAC name is 1-[[3-chlorosulfonyl-5-(trifluoromethyl)-2-pyridinyl]oxy]propan-2-yl acetate.
| Compound Name | 1-[[3-chlorosulfonyl-5-(trifluoromethyl)-2-pyridinyl]oxy]propan-2-yl acetate |
|---|---|
| PubChem CID | 126662223 |
| Molecular Formula | C11H11ClF3NO5S |
| Molecular Weight | 361.73 g/mol |
| Exact Mass | 361.00 |
| IUPAC Name | 1-[[3-chlorosulfonyl-5-(trifluoromethyl)-2-pyridinyl]oxy]propan-2-yl acetate |
| SMILES | CC(=O)OC(C)COc1ncc(C(F)(F)F)cc1S(=O)(=O)Cl |
| InChI | InChI=1S/C11H11ClF3NO5S/c1-6(21-7(2)17)5-20-10-9(22(12,18)19)3-8(4-16-10)11(13,14)15/h3-4,6H,5H2,1-2H3 |
| InChIKey | FYYXHQONHDZOBW-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 82.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.73 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |