C32H33ClF4N2O7S — CID 123263267
1-[1-[[3-[[6-[2-(2-chloro-6-fluorophenyl)ethenyl]-2-(3-methoxybut-3-enyl)-2,3-dihydro-1,4-benzoxazin-4-yl]sulfonyl]-5-(trifluoromethyl)-2-pyridinyl]oxy]propan-2-yloxy]ethanol (PubChem CID 123263267) has the molecular formula C32H33ClF4N2O7S and a molecular weight of 701.13 g/mol. Its IUPAC name is 1-[1-[[3-[[6-[2-(2-chloro-6-fluorophenyl)ethenyl]-2-(3-methoxybut-3-enyl)-2,3-dihydro-1,4-benzoxazin-4-yl]sulfonyl]-5-(trifluoromethyl)-2-pyridinyl]oxy]propan-2-yloxy]ethanol.
| Compound Name | 1-[1-[[3-[[6-[2-(2-chloro-6-fluorophenyl)ethenyl]-2-(3-methoxybut-3-enyl)-2,3-dihydro-1,4-benzoxazin-4-yl]sulfonyl]-5-(trifluoromethyl)-2-pyridinyl]oxy]propan-2-yloxy]ethanol |
|---|---|
| PubChem CID | 123263267 |
| Molecular Formula | C32H33ClF4N2O7S |
| Molecular Weight | 701.13 g/mol |
| Exact Mass | 700.16 |
| IUPAC Name | 1-[1-[[3-[[6-[2-(2-chloro-6-fluorophenyl)ethenyl]-2-(3-methoxybut-3-enyl)-2,3-dihydro-1,4-benzoxazin-4-yl]sulfonyl]-5-(trifluoromethyl)-2-pyridinyl]oxy]propan-2-yloxy]ethanol |
| SMILES | C=C(CCC1CN(S(=O)(=O)c2cc(C(F)(F)F)cnc2OCC(C)OC(C)O)c2cc(C=Cc3c(F)cccc3Cl)ccc2O1)OC |
| InChI | InChI=1S/C32H33ClF4N2O7S/c1-19(43-4)8-11-24-17-39(28-14-22(10-13-29(28)46-24)9-12-25-26(33)6-5-7-27(25)34)47(41,42)30-15-23(32(35,36)37)16-38-31(30)44-18-20(2)45-21(3)40/h5-7,9-10,12-16,20-21,24,40H,1,8,11,17-18H2,2-4H3 |
| InChIKey | QJWSCZIWRMTRCM-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 107.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.13 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|