C30H29ClF3NO4S — CID 123488272
6-[2-(2-chlorophenyl)but-1-enyl]-2-(3-methoxybut-3-enyl)-4-[3-(trifluoromethyl)phenyl]sulfonyl-2,3-dihydro-1,4-benzoxazine (PubChem CID 123488272) has the molecular formula C30H29ClF3NO4S and a molecular weight of 592.08 g/mol. Its IUPAC name is 6-[2-(2-chlorophenyl)but-1-enyl]-2-(3-methoxybut-3-enyl)-4-[3-(trifluoromethyl)phenyl]sulfonyl-2,3-dihydro-1,4-benzoxazine.
| Compound Name | 6-[2-(2-chlorophenyl)but-1-enyl]-2-(3-methoxybut-3-enyl)-4-[3-(trifluoromethyl)phenyl]sulfonyl-2,3-dihydro-1,4-benzoxazine |
|---|---|
| PubChem CID | 123488272 |
| Molecular Formula | C30H29ClF3NO4S |
| Molecular Weight | 592.08 g/mol |
| Exact Mass | 591.15 |
| IUPAC Name | 6-[2-(2-chlorophenyl)but-1-enyl]-2-(3-methoxybut-3-enyl)-4-[3-(trifluoromethyl)phenyl]sulfonyl-2,3-dihydro-1,4-benzoxazine |
| SMILES | C=C(CCC1CN(S(=O)(=O)c2cccc(C(F)(F)F)c2)c2cc(C=C(CC)c3ccccc3Cl)ccc2O1)OC |
| InChI | InChI=1S/C30H29ClF3NO4S/c1-4-22(26-10-5-6-11-27(26)31)16-21-13-15-29-28(17-21)35(19-24(39-29)14-12-20(2)38-3)40(36,37)25-9-7-8-23(18-25)30(32,33)34/h5-11,13,15-18,24H,2,4,12,14,19H2,1,3H3 |
| InChIKey | HMELCDYPGDQNLA-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.08 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|