C26H30F3NO4S — CID 144958317
(2S)-6-cyclohexyl-2-(3-methoxybut-3-enyl)-4-[3-(trifluoromethyl)phenyl]sulfonyl-2,3-dihydro-1,4-benzoxazine (PubChem CID 144958317) has the molecular formula C26H30F3NO4S and a molecular weight of 509.59 g/mol. Its IUPAC name is (2S)-6-cyclohexyl-2-(3-methoxybut-3-enyl)-4-[3-(trifluoromethyl)phenyl]sulfonyl-2,3-dihydro-1,4-benzoxazine.
| Compound Name | (2S)-6-cyclohexyl-2-(3-methoxybut-3-enyl)-4-[3-(trifluoromethyl)phenyl]sulfonyl-2,3-dihydro-1,4-benzoxazine |
|---|---|
| PubChem CID | 144958317 |
| Molecular Formula | C26H30F3NO4S |
| Molecular Weight | 509.59 g/mol |
| Exact Mass | 509.18 |
| IUPAC Name | (2S)-6-cyclohexyl-2-(3-methoxybut-3-enyl)-4-[3-(trifluoromethyl)phenyl]sulfonyl-2,3-dihydro-1,4-benzoxazine |
| SMILES | C=C(CC[C@H]1CN(S(=O)(=O)c2cccc(C(F)(F)F)c2)c2cc(C3CCCCC3)ccc2O1)OC |
| InChI | InChI=1S/C26H30F3NO4S/c1-18(33-2)11-13-22-17-30(35(31,32)23-10-6-9-21(16-23)26(27,28)29)24-15-20(12-14-25(24)34-22)19-7-4-3-5-8-19/h6,9-10,12,14-16,19,22H,1,3-5,7-8,11,13,17H2,2H3/t22-/m0/s1 |
| InChIKey | QHQVZOMVZKICNS-QFIPXVFZSA-N |
| XLogP | 6.65 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.59 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|