C17H14F3I2NO3S — CID 145183655
6-iodo-2-(2-iodoethyl)-4-[3-(trifluoromethyl)phenyl]sulfonyl-2,3-dihydro-1,4-benzoxazine (PubChem CID 145183655) has the molecular formula C17H14F3I2NO3S and a molecular weight of 623.17 g/mol. Its IUPAC name is 6-iodo-2-(2-iodoethyl)-4-[3-(trifluoromethyl)phenyl]sulfonyl-2,3-dihydro-1,4-benzoxazine.
| Compound Name | 6-iodo-2-(2-iodoethyl)-4-[3-(trifluoromethyl)phenyl]sulfonyl-2,3-dihydro-1,4-benzoxazine |
|---|---|
| PubChem CID | 145183655 |
| Molecular Formula | C17H14F3I2NO3S |
| Molecular Weight | 623.17 g/mol |
| Exact Mass | 622.87 |
| IUPAC Name | 6-iodo-2-(2-iodoethyl)-4-[3-(trifluoromethyl)phenyl]sulfonyl-2,3-dihydro-1,4-benzoxazine |
| SMILES | O=S(=O)(c1cccc(C(F)(F)F)c1)N1CC(CCI)Oc2ccc(I)cc21 |
| InChI | InChI=1S/C17H14F3I2NO3S/c18-17(19,20)11-2-1-3-14(8-11)27(24,25)23-10-13(6-7-21)26-16-5-4-12(22)9-15(16)23/h1-5,8-9,13H,6-7,10H2 |
| InChIKey | AXWOQDDUAIUXFK-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.17 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|