C20H15F3N2O4S — CID 150197509
N-(3-methylsulfonylphenyl)-2-phenoxy-5-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 150197509) has the molecular formula C20H15F3N2O4S and a molecular weight of 436.41 g/mol. Its IUPAC name is N-(3-methylsulfonylphenyl)-2-phenoxy-5-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | N-(3-methylsulfonylphenyl)-2-phenoxy-5-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 150197509 |
| Molecular Formula | C20H15F3N2O4S |
| Molecular Weight | 436.41 g/mol |
| Exact Mass | 436.07 |
| IUPAC Name | N-(3-methylsulfonylphenyl)-2-phenoxy-5-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | CS(=O)(=O)c1cccc(NC(=O)c2cc(C(F)(F)F)cnc2Oc2ccccc2)c1 |
| InChI | InChI=1S/C20H15F3N2O4S/c1-30(27,28)16-9-5-6-14(11-16)25-18(26)17-10-13(20(21,22)23)12-24-19(17)29-15-7-3-2-4-8-15/h2-12H,1H3,(H,25,26) |
| InChIKey | FOTIECHOIUCPHH-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.41 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |